diff options
Diffstat (limited to 'src/smt/preprocessor.cpp')
-rw-r--r-- | src/smt/preprocessor.cpp | 156 |
1 files changed, 156 insertions, 0 deletions
diff --git a/src/smt/preprocessor.cpp b/src/smt/preprocessor.cpp new file mode 100644 index 000000000..ea5ef2bad --- /dev/null +++ b/src/smt/preprocessor.cpp @@ -0,0 +1,156 @@ +/********************* */ +/*! \file preprocessor.cpp + ** \verbatim + ** Top contributors (to current version): + ** Andrew Reynolds + ** This file is part of the CVC4 project. + ** Copyright (c) 2009-2020 by the authors listed in the file AUTHORS + ** in the top-level source directory) and their institutional affiliations. + ** All rights reserved. See the file COPYING in the top-level source + ** directory for licensing information.\endverbatim + ** + ** \brief The preprocessor of the SMT engine. + **/ + +#include "smt/preprocessor.h" + +#include "options/smt_options.h" +#include "smt/abstract_values.h" +#include "smt/assertions.h" +#include "smt/command.h" +#include "smt/smt_engine.h" + +using namespace CVC4::theory; +using namespace CVC4::kind; + +namespace CVC4 { +namespace smt { + +Preprocessor::Preprocessor(SmtEngine& smt, + context::UserContext* u, + AbstractValues& abs) + : d_smt(smt), + d_absValues(abs), + d_propagator(true, true), + d_assertionsProcessed(u, false), + d_processor(smt, *smt.getResourceManager()), + d_rtf(u) +{ +} + +Preprocessor::~Preprocessor() +{ + if (d_propagator.getNeedsFinish()) + { + d_propagator.finish(); + d_propagator.setNeedsFinish(false); + } +} + +void Preprocessor::finishInit() +{ + d_ppContext.reset(new preprocessing::PreprocessingPassContext( + &d_smt, &d_rtf, &d_propagator)); + + // initialize the preprocessing passes + d_processor.finishInit(d_ppContext.get()); +} + +bool Preprocessor::process(Assertions& as) +{ + preprocessing::AssertionPipeline& ap = as.getAssertionPipeline(); + + // should not be called if empty + Assert(ap.size() != 0) << "Can only preprocess a non-empty list of assertions"; + + if (d_assertionsProcessed && options::incrementalSolving()) + { + // TODO(b/1255): Substitutions in incremental mode should be managed with a + // proper data structure. + ap.enableStoreSubstsInAsserts(); + } + else + { + ap.disableStoreSubstsInAsserts(); + } + + // process the assertions, return true if no conflict is discovered + return d_processor.apply(as); +} + +void Preprocessor::postprocess(Assertions& as) +{ + preprocessing::AssertionPipeline& ap = as.getAssertionPipeline(); + // if incremental, compute which variables are assigned + if (options::incrementalSolving()) + { + d_ppContext->recordSymbolsInAssertions(ap.ref()); + } + + // mark that we've processed assertions + d_assertionsProcessed = true; +} + +void Preprocessor::clearLearnedLiterals() +{ + d_propagator.getLearnedLiterals().clear(); +} + +void Preprocessor::cleanup() { d_processor.cleanup(); } + +RemoveTermFormulas& Preprocessor::getTermFormulaRemover() { return d_rtf; } + +Node Preprocessor::expandDefinitions(const Node& n, bool expandOnly) +{ + std::unordered_map<Node, Node, NodeHashFunction> cache; + return expandDefinitions(n, cache, expandOnly); +} + +Node Preprocessor::expandDefinitions( + const Node& node, + std::unordered_map<Node, Node, NodeHashFunction>& cache, + bool expandOnly) +{ + Trace("smt") << "SMT expandDefinitions(" << node << ")" << endl; + // Substitute out any abstract values in node. + Node n = d_absValues.substituteAbstractValues(node); + if (options::typeChecking()) + { + // Ensure node is type-checked at this point. + n.getType(true); + } + // expand only = true + return d_processor.expandDefinitions(n, cache, expandOnly); +} + +Node Preprocessor::simplify(const Node& node, bool removeItes) +{ + Trace("smt") << "SMT simplify(" << node << ")" << endl; + if (Dump.isOn("benchmark")) + { + Dump("benchmark") << SimplifyCommand(node.toExpr()); + } + Node nas = d_absValues.substituteAbstractValues(node); + if (options::typeChecking()) + { + // ensure node is type-checked at this point + nas.getType(true); + } + std::unordered_map<Node, Node, NodeHashFunction> cache; + Node n = d_processor.expandDefinitions(nas, cache); + Node ns = applySubstitutions(n); + if (removeItes) + { + // also remove ites if asked + ns = d_rtf.replace(ns); + } + return ns; +} + +Node Preprocessor::applySubstitutions(TNode node) +{ + return Rewriter::rewrite(d_ppContext->getTopLevelSubstitutions().apply(node)); +} + +} // namespace smt +} // namespace CVC4 |