summaryrefslogtreecommitdiff
path: root/src
diff options
context:
space:
mode:
authorTim King <taking@cs.nyu.edu>2010-06-29 20:53:47 +0000
committerTim King <taking@cs.nyu.edu>2010-06-29 20:53:47 +0000
commite792bb8628ea7010fa9c452bf1aa7ba1b60291a3 (patch)
treeddc12f92092627b7aee2a63dca8dd66279b2970e /src
parente7e9c10006b5b243a73832ed97c5dec79df6c90a (diff)
Merging the unate-propagator branch into the trunk. This is a big update so expect a little turbulence. This commit will not compile. There will be a second commit that fixes this in a moment. I am delaying a change to avoid svn whining about a conflict.
Diffstat (limited to 'src')
-rw-r--r--src/prop/cnf_stream.cpp41
-rw-r--r--src/prop/cnf_stream.h36
-rw-r--r--src/prop/minisat/core/Solver.C111
-rw-r--r--src/prop/minisat/core/Solver.h23
-rw-r--r--src/prop/minisat/simp/SimpSolver.C6
-rw-r--r--src/prop/sat.cpp45
-rw-r--r--src/prop/sat.h14
-rw-r--r--src/theory/Makefile.am1
-rw-r--r--src/theory/arith/Makefile.am3
-rw-r--r--src/theory/arith/arith_propagator.cpp347
-rw-r--r--src/theory/arith/arith_propagator.h111
-rw-r--r--src/theory/arith/ordered_bounds_list.h212
-rw-r--r--src/theory/arith/theory_arith.cpp93
-rw-r--r--src/theory/arith/theory_arith.h7
-rw-r--r--src/theory/theory.cpp16
-rw-r--r--src/theory/theory.h2
-rw-r--r--src/theory/theory_engine.h46
-rw-r--r--src/theory/theory_test_utils.h81
-rw-r--r--src/theory/uf/theory_uf.cpp2
19 files changed, 1115 insertions, 82 deletions
diff --git a/src/prop/cnf_stream.cpp b/src/prop/cnf_stream.cpp
index 45f7ab398..9136a73c3 100644
--- a/src/prop/cnf_stream.cpp
+++ b/src/prop/cnf_stream.cpp
@@ -102,26 +102,10 @@ Node CnfStream::getNode(const SatLiteral& literal) {
return node;
}
-SatLiteral CnfStream::getLiteral(TNode node) {
- TranslationCache::iterator find = d_translationCache.find(node);
- Assert(find != d_translationCache.end(), "Literal not in the CNF Cache");
- SatLiteral literal = find->second;
- Debug("cnf") << "CnfStream::getLiteral(" << node << ") => " << literal << std::endl;
- return literal;
-}
-
-const CnfStream::NodeCache& CnfStream::getNodeCache() const {
- return d_nodeCache;
-}
-
-const CnfStream::TranslationCache& CnfStream::getTranslationCache() const {
- return d_translationCache;
-}
-
-SatLiteral TseitinCnfStream::handleAtom(TNode node) {
+SatLiteral CnfStream::convertAtom(TNode node) {
Assert(!isCached(node), "atom already mapped!");
- Debug("cnf") << "handleAtom(" << node << ")" << endl;
+ Debug("cnf") << "convertAtom(" << node << ")" << endl;
bool theoryLiteral = node.getKind() != kind::VARIABLE;
SatLiteral lit = newLiteral(node, theoryLiteral);
@@ -137,6 +121,23 @@ SatLiteral TseitinCnfStream::handleAtom(TNode node) {
return lit;
}
+SatLiteral CnfStream::getLiteral(TNode node, bool create /* = false */) {
+ TranslationCache::iterator find = d_translationCache.find(node);
+ SatLiteral literal;
+ if(create) {
+ if(find == d_translationCache.end()) {
+ literal = convertAtom(node);
+ } else {
+ literal = find->second;
+ }
+ } else {
+ Assert(find != d_translationCache.end(), "Literal not in the CNF Cache");
+ literal = find->second;
+ }
+ Debug("cnf") << "CnfStream::getLiteral(" << node << ", create = " << create << ") => " << literal << std::endl;
+ return literal;
+}
+
SatLiteral TseitinCnfStream::handleXor(TNode xorNode) {
Assert(!isCached(xorNode), "Atom already mapped!");
Assert(xorNode.getKind() == XOR, "Expecting an XOR expression!");
@@ -366,10 +367,10 @@ SatLiteral TseitinCnfStream::toCNF(TNode node, bool negated) {
default:
{
//TODO make sure this does not contain any boolean substructure
- nodeLit = handleAtom(node);
+ nodeLit = convertAtom(node);
//Unreachable();
//Node atomic = handleNonAtomicNode(node);
- //return isCached(atomic) ? lookupInCache(atomic) : handleAtom(atomic);
+ //return isCached(atomic) ? lookupInCache(atomic) : convertAtom(atomic);
}
}
}
diff --git a/src/prop/cnf_stream.h b/src/prop/cnf_stream.h
index abb69f590..ba87cf269 100644
--- a/src/prop/cnf_stream.h
+++ b/src/prop/cnf_stream.h
@@ -127,6 +127,16 @@ protected:
*/
SatLiteral newLiteral(TNode node, bool theoryLiteral = false);
+ /**
+ * Constructs a new literal for an atom and returns it. Calls
+ * newLiteral().
+ *
+ * @param node the node to convert; there should be no boolean
+ * structure in this expression. Assumed to not be in the
+ * translation cache.
+ */
+ SatLiteral convertAtom(TNode node);
+
public:
/**
@@ -161,14 +171,25 @@ public:
/**
* Returns the literal that represents the given node in the SAT CNF
- * representation. [Presumably there are some constraints on the kind
- * of node? E.g., it needs to be a boolean? -Chris]
- *
+ * representation.
+ * @param node [Presumably there are some constraints on the kind of
+ * node? E.g., it needs to be a boolean? -Chris]
+ * @param create Controls whether or not to create a new SAT literal
+ * mapping for Node if it does not exist. This exists to break
+ * circular dependencies, where an atom is converted and asserted to
+ * the SAT solver, which propagates it immediately since it's a
+ * unit, which can theory-propagate additional literals that don't
+ * yet have a SAT literal mapping.
*/
- SatLiteral getLiteral(TNode node);
+ SatLiteral getLiteral(TNode node, bool create = false);
+
+ const TranslationCache& getTranslationCache() const {
+ return d_translationCache;
+ }
- const TranslationCache& getTranslationCache() const;
- const NodeCache& getNodeCache() const;
+ const NodeCache& getNodeCache() const {
+ return d_nodeCache;
+ }
}; /* class CnfStream */
/**
@@ -178,7 +199,7 @@ public:
* will be equivalent to each subexpression in the constructed equi-satisfiable
* formula, then substitute the new literal for the formula, and so on,
* recursively.
- *
+ *
* This implementation does this in a single recursive pass. [??? -Chris]
*/
class TseitinCnfStream : public CnfStream {
@@ -211,7 +232,6 @@ private:
// - returning l
//
// handleX( n ) can assume that n is not in d_translationCache
- SatLiteral handleAtom(TNode node);
SatLiteral handleNot(TNode node);
SatLiteral handleXor(TNode node);
SatLiteral handleImplies(TNode node);
diff --git a/src/prop/minisat/core/Solver.C b/src/prop/minisat/core/Solver.C
index 8533e191b..1667af20d 100644
--- a/src/prop/minisat/core/Solver.C
+++ b/src/prop/minisat/core/Solver.C
@@ -29,6 +29,28 @@ namespace CVC4 {
namespace prop {
namespace minisat {
+Clause* Solver::lazy_reason = reinterpret_cast<Clause*>(1);
+
+Clause* Solver::getReason(Lit l)
+{
+ if (reason[var(l)] != lazy_reason) return reason[var(l)];
+ // Get the explanation from the theory
+ SatClause explanation;
+ if (value(l) == l_True) {
+ proxy->explainPropagation(l, explanation);
+ assert(explanation[0] == l);
+ } else {
+ proxy->explainPropagation(~l, explanation);
+ assert(explanation[0] == ~l);
+ }
+ Clause* real_reason = Clause_new(explanation, true);
+ reason[var(l)] = real_reason;
+ // Add it to the database
+ learnts.push(real_reason);
+ attachClause(*real_reason);
+ return real_reason;
+}
+
Solver::Solver(SatSolver* proxy, context::Context* context) :
// SMT stuff
@@ -122,7 +144,7 @@ bool Solver::addClause(vec<Lit>& ps, ClauseType type)
assert(type != CLAUSE_LEMMA);
assert(value(ps[0]) == l_Undef);
uncheckedEnqueue(ps[0]);
- return ok = (propagate() == NULL);
+ return ok = (propagate(CHECK_WITHOUTH_PROPAGATION_QUICK) == NULL);
}else{
Clause* c = Clause_new(ps, false);
clauses.push(c);
@@ -282,7 +304,7 @@ void Solver::analyze(Clause* confl, vec<Lit>& out_learnt, int& out_btlevel)
// Select next clause to look at:
while (!seen[var(trail[index--])]);
p = trail[index+1];
- confl = reason[var(p)];
+ confl = getReason(p);
seen[var(p)] = 0;
pathC--;
@@ -299,12 +321,12 @@ void Solver::analyze(Clause* confl, vec<Lit>& out_learnt, int& out_btlevel)
out_learnt.copyTo(analyze_toclear);
for (i = j = 1; i < out_learnt.size(); i++)
- if (reason[var(out_learnt[i])] == NULL || !litRedundant(out_learnt[i], abstract_level))
+ if (getReason(out_learnt[i]) == NULL || !litRedundant(out_learnt[i], abstract_level))
out_learnt[j++] = out_learnt[i];
}else{
out_learnt.copyTo(analyze_toclear);
for (i = j = 1; i < out_learnt.size(); i++){
- Clause& c = *reason[var(out_learnt[i])];
+ Clause& c = *getReason(out_learnt[i]);
for (int k = 1; k < c.size(); k++)
if (!seen[var(c[k])] && level[var(c[k])] > 0){
out_learnt[j++] = out_learnt[i];
@@ -342,13 +364,13 @@ bool Solver::litRedundant(Lit p, uint32_t abstract_levels)
analyze_stack.clear(); analyze_stack.push(p);
int top = analyze_toclear.size();
while (analyze_stack.size() > 0){
- assert(reason[var(analyze_stack.last())] != NULL);
+ assert(getReason(analyze_stack.last()) != NULL);
Clause& c = *reason[var(analyze_stack.last())]; analyze_stack.pop();
for (int i = 1; i < c.size(); i++){
Lit p = c[i];
if (!seen[var(p)] && level[var(p)] > 0){
- if (reason[var(p)] != NULL && (abstractLevel(var(p)) & abstract_levels) != 0){
+ if (getReason(p) != NULL && (abstractLevel(var(p)) & abstract_levels) != 0){
seen[var(p)] = 1;
analyze_stack.push(p);
analyze_toclear.push(p);
@@ -415,42 +437,74 @@ void Solver::uncheckedEnqueue(Lit p, Clause* from)
polarity [var(p)] = sign(p);
trail.push(p);
- if (theory[var(p)]) {
+ if (theory[var(p)] && from != lazy_reason) {
// Enqueue to the theory
proxy->enqueueTheoryLiteral(p);
}
}
-Clause* Solver::propagate()
+Clause* Solver::propagate(TheoryCheckType type)
{
Clause* confl = NULL;
- while(qhead < trail.size()) {
- confl = propagateBool();
- if (confl != NULL) break;
- confl = propagateTheory();
- if (confl != NULL) break;
+ // If this is the final check, no need for Boolean propagation and
+ // theory propagation
+ if (type == CHECK_WITHOUTH_PROPAGATION_FINAL) {
+ return theoryCheck(theory::Theory::FULL_EFFORT);
}
+ // The effort we will be using to theory check
+ theory::Theory::Effort effort = type == CHECK_WITHOUTH_PROPAGATION_QUICK ?
+ theory::Theory::QUICK_CHECK : theory::Theory::STANDARD;
+
+ // Keep running until we have checked everything, we
+ // have no conflict and no new literals have been asserted
+ bool new_assertions;
+ do {
+ new_assertions = false;
+ while(qhead < trail.size()) {
+ confl = propagateBool();
+ if (confl != NULL) break;
+ confl = theoryCheck(effort);
+ if (confl != NULL) break;
+ }
+
+ if (confl == NULL && type == CHECK_WITH_PROPAGATION_STANDARD) {
+ new_assertions = propagateTheory();
+ if (!new_assertions) break;
+ }
+ } while (new_assertions);
+
return confl;
}
+bool Solver::propagateTheory() {
+ std::vector<Lit> propagatedLiterals;
+ proxy->theoryPropagate(propagatedLiterals);
+ const unsigned i_end = propagatedLiterals.size();
+ for (unsigned i = 0; i < i_end; ++ i) {
+ uncheckedEnqueue(propagatedLiterals[i], lazy_reason);
+ }
+ proxy->clearPropagatedLiterals();
+ return propagatedLiterals.size() > 0;
+}
+
/*_________________________________________________________________________________________________
|
-| propagateTheory : [void] -> [Clause*]
+| theoryCheck: [void] -> [Clause*]
|
| Description:
-| Propagates all enqueued theory facts. If a conflict arises, the conflicting clause is returned,
-| otherwise NULL.
+| Checks all enqueued theory facts for satisfiability. If a conflict arises, the conflicting
+| clause is returned, otherwise NULL.
|
| Note: the propagation queue might be NOT empty
|________________________________________________________________________________________________@*/
-Clause* Solver::propagateTheory()
+Clause* Solver::theoryCheck(theory::Theory::Effort effort)
{
Clause* c = NULL;
SatClause clause;
- proxy->theoryCheck(clause);
+ proxy->theoryCheck(effort, clause);
int clause_size = clause.size();
Assert(clause_size != 1, "Can't handle unit clause explanations");
if(clause_size > 0) {
@@ -598,7 +652,7 @@ bool Solver::simplify()
{
assert(decisionLevel() == 0);
- if (!ok || propagate() != NULL)
+ if (!ok || propagate(CHECK_WITHOUTH_PROPAGATION_QUICK) != NULL)
return ok = false;
if (nAssigns() == simpDB_assigns || (simpDB_props > 0))
@@ -643,9 +697,9 @@ lbool Solver::search(int nof_conflicts, int nof_learnts)
starts++;
bool first = true;
-
+ TheoryCheckType check_type = CHECK_WITH_PROPAGATION_STANDARD;
for (;;){
- Clause* confl = propagate();
+ Clause* confl = propagate(check_type);
if (confl != NULL){
// CONFLICT
conflicts++; conflictC++;
@@ -671,9 +725,16 @@ lbool Solver::search(int nof_conflicts, int nof_learnts)
varDecayActivity();
claDecayActivity();
+ // We have a conflict so, we are going back to standard checks
+ check_type = CHECK_WITH_PROPAGATION_STANDARD;
+
}else{
// NO CONFLICT
+ // If this was a final check, we are satisfiable
+ if (check_type == CHECK_WITHOUTH_PROPAGATION_FINAL)
+ return l_True;
+
if (nof_conflicts >= 0 && conflictC >= nof_conflicts){
// Reached bound on number of conflicts:
progress_estimate = progressEstimate();
@@ -709,9 +770,11 @@ lbool Solver::search(int nof_conflicts, int nof_learnts)
decisions++;
next = pickBranchLit(polarity_mode, random_var_freq);
- if (next == lit_Undef)
- // Model found:
- return l_True;
+ if (next == lit_Undef) {
+ // We need to do a full theory check to confirm
+ check_type = CHECK_WITHOUTH_PROPAGATION_FINAL;
+ continue;
+ }
}
// Increase decision level and enqueue 'next'
diff --git a/src/prop/minisat/core/Solver.h b/src/prop/minisat/core/Solver.h
index 312fe44d5..2e44803e9 100644
--- a/src/prop/minisat/core/Solver.h
+++ b/src/prop/minisat/core/Solver.h
@@ -23,6 +23,7 @@ OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWA
#define __CVC4__PROP__MINISAT__SOLVER_H
#include "context/context.h"
+#include "theory/theory.h"
#include <cstdio>
#include <cassert>
@@ -161,7 +162,11 @@ protected:
vec<int> trail_lim; // Separator indices for different decision levels in 'trail'.
vec<Clause*> lemmas; // List of lemmas we added (context dependent)
vec<int> lemmas_lim; // Separator indices for different decision levels in 'lemmas'.
- vec<Clause*> reason; // 'reason[var]' is the clause that implied the variables current value, or 'NULL' if none.
+ static Clause* lazy_reason; // The mark when we need to ask the theory engine for a reason
+ vec<Clause*> reason; // 'reason[var]' is the clause that implied the variables current value, lazy_reason if theory propagated, or 'NULL' if none.
+
+ Clause* getReason(Lit l); // Returns the reason, or asks the theory for an explanation
+
vec<int> level; // 'level[var]' contains the level at which the assignment was made.
int qhead; // Head of queue (as index into the trail -- no more explicit propagation queue in MiniSat).
int lhead; // Head of the lemma stack (for backtracking)
@@ -181,6 +186,15 @@ protected:
vec<Lit> analyze_toclear;
vec<Lit> add_tmp;
+ enum TheoryCheckType {
+ // Quick check, but don't perform theory propagation
+ CHECK_WITHOUTH_PROPAGATION_QUICK,
+ // Check and perform theory propagation
+ CHECK_WITH_PROPAGATION_STANDARD,
+ // The SAT problem is satisfiable, perform a full theory check
+ CHECK_WITHOUTH_PROPAGATION_FINAL
+ };
+
// Main internal methods:
//
void insertVarOrder (Var x); // Insert a variable in the decision order priority queue.
@@ -188,9 +202,10 @@ protected:
void newDecisionLevel (); // Begins a new decision level.
void uncheckedEnqueue (Lit p, Clause* from = NULL); // Enqueue a literal. Assumes value of literal is undefined.
bool enqueue (Lit p, Clause* from = NULL); // Test if fact 'p' contradicts current state, enqueue otherwise.
- Clause* propagate (); // Perform Boolean and Theory. Returns possibly conflicting clause.
+ Clause* propagate (TheoryCheckType type); // Perform Boolean and Theory. Returns possibly conflicting clause.
Clause* propagateBool (); // Perform Boolean propagation. Returns possibly conflicting clause.
- Clause* propagateTheory (); // Perform Theory propagation. Returns possibly conflicting clause.
+ bool propagateTheory (); // Perform Theory propagation. Return true if any literals were asserted.
+ Clause* theoryCheck (theory::Theory::Effort effort); // Perform a theory satisfiability check. Returns possibly conflicting clause.
void cancelUntil (int level); // Backtrack until a certain level.
void analyze (Clause* confl, vec<Lit>& out_learnt, int& out_btlevel); // (bt = backtrack)
void analyzeFinal (Lit p, vec<Lit>& out_conflict); // COULD THIS BE IMPLEMENTED BY THE ORDINARIY "analyze" BY SOME REASONABLE GENERALIZATION?
@@ -216,7 +231,7 @@ protected:
// Misc:
//
- int decisionLevel () const; // Gives the current decisionlevel.
+ int decisionLevel () const; // Gives the current decision level.
uint32_t abstractLevel (Var x) const; // Used to represent an abstraction of sets of decision levels.
double progressEstimate () const; // DELETE THIS ?? IT'S NOT VERY USEFUL ...
diff --git a/src/prop/minisat/simp/SimpSolver.C b/src/prop/minisat/simp/SimpSolver.C
index 9aad6aea7..00f93402f 100644
--- a/src/prop/minisat/simp/SimpSolver.C
+++ b/src/prop/minisat/simp/SimpSolver.C
@@ -212,7 +212,7 @@ bool SimpSolver::strengthenClause(Clause& c, Lit l)
updateElimHeap(var(l));
}
- return c.size() == 1 ? enqueue(c[0]) && propagate() == NULL : true;
+ return c.size() == 1 ? enqueue(c[0]) && propagate(CHECK_WITHOUTH_PROPAGATION_QUICK) == NULL : true;
}
@@ -312,7 +312,7 @@ bool SimpSolver::implied(const vec<Lit>& c)
uncheckedEnqueue(~c[i]);
}
- bool result = propagate() != NULL;
+ bool result = propagate(CHECK_WITHOUTH_PROPAGATION_QUICK) != NULL;
cancelUntil(0);
return result;
}
@@ -394,7 +394,7 @@ bool SimpSolver::asymm(Var v, Clause& c)
else
l = c[i];
- if (propagate() != NULL){
+ if (propagate(CHECK_WITHOUTH_PROPAGATION_QUICK) != NULL){
cancelUntil(0);
asymm_lits++;
if (!strengthenClause(c, l))
diff --git a/src/prop/sat.cpp b/src/prop/sat.cpp
index 207bda4db..a7b536a57 100644
--- a/src/prop/sat.cpp
+++ b/src/prop/sat.cpp
@@ -26,9 +26,9 @@
namespace CVC4 {
namespace prop {
-void SatSolver::theoryCheck(SatClause& conflict) {
+void SatSolver::theoryCheck(theory::Theory::Effort effort, SatClause& conflict) {
// Try theory propagation
- bool ok = d_theoryEngine->check(theory::Theory::FULL_EFFORT);
+ bool ok = d_theoryEngine->check(effort);
// If in conflict construct the conflict clause
if (!ok) {
// We have a conflict, get it
@@ -47,6 +47,47 @@ void SatSolver::theoryCheck(SatClause& conflict) {
}
}
+void SatSolver::theoryPropagate(std::vector<SatLiteral>& output) {
+ // Propagate
+ d_theoryEngine->propagate();
+ // Get the propagated literals
+ const std::vector<TNode>& outputNodes = d_theoryEngine->getPropagatedLiterals();
+ // If any literals, make a clause
+ const unsigned i_end = outputNodes.size();
+ for (unsigned i = 0; i < i_end; ++ i) {
+ Debug("prop-explain") << "theoryPropagate() => " << outputNodes[i].toString() << endl;
+ // The second argument ("true") instructs the CNF stream to create
+ // a new literal mapping if it doesn't exist. This can happen due
+ // to a circular dependence, if a SAT literal "a" is asserted as a
+ // unit to the SAT solver, a round of theory propagation can occur
+ // before all Nodes have SAT variable mappings.
+ SatLiteral l = d_cnfStream->getLiteral(outputNodes[i], true);
+ output.push_back(l);
+ }
+}
+
+void SatSolver::explainPropagation(SatLiteral l, SatClause& explanation) {
+ TNode lNode = d_cnfStream->getNode(l);
+ Debug("prop-explain") << "explainPropagation(" << lNode.toString() << ")" << endl;
+ Node theoryExplanation = d_theoryEngine->getExplanation(lNode);
+ Debug("prop-explain") << "explainPropagation() => " << theoryExplanation.toString() << endl;
+ if (lNode.getKind() == kind::AND) {
+ Node::const_iterator it = theoryExplanation.begin();
+ Node::const_iterator it_end = theoryExplanation.end();
+ explanation.push(l);
+ for (; it != it_end; ++ it) {
+ explanation.push(~d_cnfStream->getLiteral(*it));
+ }
+ } else {
+ explanation.push(l);
+ explanation.push(~d_cnfStream->getLiteral(theoryExplanation));
+ }
+}
+
+void SatSolver::clearPropagatedLiterals() {
+ d_theoryEngine->clearPropagatedLiterals();
+}
+
void SatSolver::enqueueTheoryLiteral(const SatLiteral& l) {
Node literalNode = d_cnfStream->getNode(l);
Debug("prop") << "enqueueing theory literal " << l << " " << literalNode << std::endl;
diff --git a/src/prop/sat.h b/src/prop/sat.h
index f64697d7b..992d8ecd2 100644
--- a/src/prop/sat.h
+++ b/src/prop/sat.h
@@ -27,6 +27,7 @@
#include "util/options.h"
#include "util/stats.h"
+#include "theory/theory.h"
#ifdef __CVC4_USE_MINISAT
@@ -199,7 +200,13 @@ public:
SatVariable newVar(bool theoryAtom = false);
- void theoryCheck(SatClause& conflict);
+ void theoryCheck(theory::Theory::Effort effort, SatClause& conflict);
+
+ void explainPropagation(SatLiteral l, SatClause& explanation);
+
+ void theoryPropagate(std::vector<SatLiteral>& output);
+
+ void clearPropagatedLiterals();
void enqueueTheoryLiteral(const SatLiteral& l);
@@ -229,6 +236,11 @@ inline SatSolver::SatSolver(PropEngine* propEngine, TheoryEngine* theoryEngine,
// Make minisat reuse the literal values
d_minisat->polarity_mode = minisat::SimpSolver::polarity_user;
+ // No random choices
+ if(debugTagIsOn("no_rnd_decisions")){
+ d_minisat->random_var_freq = 0;
+ }
+
d_statistics.init(d_minisat);
}
diff --git a/src/theory/Makefile.am b/src/theory/Makefile.am
index 7cfc1571b..d0d2f23d7 100644
--- a/src/theory/Makefile.am
+++ b/src/theory/Makefile.am
@@ -9,6 +9,7 @@ libtheory_la_SOURCES = \
@srcdir@/theoryof_table.h \
theory_engine.h \
theory_engine.cpp \
+ theory_test_utils.h \
theory.h \
theory.cpp
diff --git a/src/theory/arith/Makefile.am b/src/theory/arith/Makefile.am
index 83d44e285..37df73edd 100644
--- a/src/theory/arith/Makefile.am
+++ b/src/theory/arith/Makefile.am
@@ -15,10 +15,13 @@ libarith_la_SOURCES = \
delta_rational.cpp \
partial_model.h \
partial_model.cpp \
+ ordered_bounds_list.h \
basic.h \
normal.h \
slack.h \
tableau.h \
+ arith_propagator.h \
+ arith_propagator.cpp \
theory_arith.h \
theory_arith.cpp
diff --git a/src/theory/arith/arith_propagator.cpp b/src/theory/arith/arith_propagator.cpp
new file mode 100644
index 000000000..e40575054
--- /dev/null
+++ b/src/theory/arith/arith_propagator.cpp
@@ -0,0 +1,347 @@
+#include "theory/arith/arith_propagator.h"
+#include "theory/arith/arith_utilities.h"
+
+#include <list>
+
+using namespace CVC4;
+using namespace CVC4::theory;
+using namespace CVC4::theory::arith;
+using namespace CVC4::theory::arith::propagator;
+
+using namespace CVC4::kind;
+
+using namespace std;
+
+ArithUnatePropagator::ArithUnatePropagator(context::Context* cxt) :
+ d_assertions(cxt), d_pendingAssertions(cxt,0)
+{ }
+
+
+bool acceptedKinds(Kind k){
+ switch(k){
+ case EQUAL:
+ case LEQ:
+ case GEQ:
+ return true;
+ default:
+ return false;
+ }
+}
+
+void ArithUnatePropagator::addAtom(TNode atom){
+ Assert(acceptedKinds(atom.getKind()));
+
+ TNode left = atom[0];
+ TNode right = atom[1];
+
+ if(!leftIsSetup(left)){
+ setupLefthand(left);
+ }
+
+ switch(atom.getKind()){
+ case EQUAL:
+ {
+ OrderedBoundsList* eqList = left.getAttribute(propagator::PropagatorEqList());
+ Assert(!eqList->contains(atom));
+ eqList->append(atom);
+ break;
+ }
+ case LEQ:
+ {
+ OrderedBoundsList* leqList = left.getAttribute(propagator::PropagatorLeqList());
+ Assert(! leqList->contains(atom));
+ leqList->append(atom);
+ break;
+ }
+ break;
+ case GEQ:
+ {
+ OrderedBoundsList* geqList = left.getAttribute(propagator::PropagatorGeqList());
+ Assert(! geqList->contains(atom));
+ geqList->append(atom);
+ break;
+ }
+ default:
+ Unreachable();
+ }
+}
+bool ArithUnatePropagator::leftIsSetup(TNode left){
+ return left.hasAttribute(propagator::PropagatorEqList());
+}
+
+void ArithUnatePropagator::setupLefthand(TNode left){
+ Assert(!leftIsSetup(left));
+
+ OrderedBoundsList* eqList = new OrderedBoundsList();
+ OrderedBoundsList* geqList = new OrderedBoundsList();
+ OrderedBoundsList* leqList = new OrderedBoundsList();
+
+ left.setAttribute(propagator::PropagatorEqList(), eqList);
+ left.setAttribute(propagator::PropagatorLeqList(), leqList);
+ left.setAttribute(propagator::PropagatorGeqList(), geqList);
+}
+
+void ArithUnatePropagator::assertLiteral(TNode lit){
+
+ if(lit.getKind() == NOT){
+ Assert(!lit[0].getAttribute(propagator::PropagatorMarked()));
+ lit[0].setAttribute(propagator::PropagatorMarked(), true);
+ }else{
+ Assert(!lit.getAttribute(propagator::PropagatorMarked()));
+ lit.setAttribute(propagator::PropagatorMarked(), true);
+ }
+ d_assertions.push_back(lit);
+}
+
+std::vector<Node> ArithUnatePropagator::getImpliedLiterals(){
+ std::vector<Node> impliedButNotAsserted;
+
+ while(d_pendingAssertions < d_assertions.size()){
+ TNode assertion = d_assertions[d_pendingAssertions];
+ d_pendingAssertions = d_pendingAssertions + 1;
+
+ enqueueImpliedLiterals(assertion, impliedButNotAsserted);
+ }
+
+ if(debugTagIsOn("arith::propagator")){
+ for(std::vector<Node>::iterator i = impliedButNotAsserted.begin(),
+ endIter = impliedButNotAsserted.end(); i != endIter; ++i){
+ Node imp = *i;
+ Debug("arith::propagator") << explain(imp) << " (prop)-> " << imp << endl;
+ }
+ }
+
+ return impliedButNotAsserted;
+}
+
+/** This function is effectively a case split. */
+void ArithUnatePropagator::enqueueImpliedLiterals(TNode lit, std::vector<Node>& buffer){
+ switch(lit.getKind()){
+ case EQUAL:
+ enqueueEqualityImplications(lit, buffer);
+ break;
+ case LEQ:
+ enqueueUpperBoundImplications(lit, lit, buffer);
+ break;
+ case GEQ:
+ enqueueLowerBoundImplications(lit, lit, buffer);
+ break;
+ case NOT:
+ {
+ TNode under = lit[0];
+ switch(under.getKind()){
+ case EQUAL:
+ //Do nothing
+ break;;
+ case LEQ:
+ enqueueLowerBoundImplications(under, lit, buffer);
+ break;
+ case GEQ:
+ enqueueUpperBoundImplications(under, lit, buffer);
+ break;
+ default:
+ Unreachable();
+ }
+ break;
+ }
+ default:
+ Unreachable();
+ }
+}
+
+/**
+ * An equality (x = c) has been asserted.
+ * In this case we can propagate everything by comparing against the other constants.
+ */
+void ArithUnatePropagator::enqueueEqualityImplications(TNode orig, std::vector<Node>& buffer){
+ TNode left = orig[0];
+ TNode right = orig[1];
+ const Rational& c = right.getConst<Rational>();
+
+ OrderedBoundsList* eqList = left.getAttribute(propagator::PropagatorEqList());
+ OrderedBoundsList* leqList = left.getAttribute(propagator::PropagatorLeqList());
+ OrderedBoundsList* geqList = left.getAttribute(propagator::PropagatorGeqList());
+
+
+ /* (x = c) /\ (c !=d) => (x != d) */
+ for(OrderedBoundsList::iterator i = eqList->begin(); i != eqList->end(); ++i){
+ TNode eq = *i;
+ Assert(eq.getKind() == EQUAL);
+ if(!eq.getAttribute(propagator::PropagatorMarked())){ //Note that (x = c) is marked
+ Assert(eq[1].getConst<Rational>() != c);
+
+ eq.setAttribute(propagator::PropagatorMarked(), true);
+
+ Node neq = NodeManager::currentNM()->mkNode(NOT, eq);
+ neq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(neq);
+ }
+ }
+ for(OrderedBoundsList::iterator i = leqList->begin(); i != leqList->end(); ++i){
+ TNode leq = *i;
+ Assert(leq.getKind() == LEQ);
+ if(!leq.getAttribute(propagator::PropagatorMarked())){
+ leq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = leq[1].getConst<Rational>();
+ if(c <= d){
+ /* (x = c) /\ (c <= d) => (x <= d) */
+ leq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(leq);
+ }else{
+ /* (x = c) /\ (c > d) => (x > d) */
+ Node gt = NodeManager::currentNM()->mkNode(NOT, leq);
+ gt.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(gt);
+ }
+ }
+ }
+
+ for(OrderedBoundsList::iterator i = geqList->begin(); i != geqList->end(); ++i){
+ TNode geq = *i;
+ Assert(geq.getKind() == GEQ);
+ if(!geq.getAttribute(propagator::PropagatorMarked())){
+ geq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = geq[1].getConst<Rational>();
+ if(c >= d){
+ /* (x = c) /\ (c >= d) => (x >= d) */
+ geq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(geq);
+ }else{
+ /* (x = c) /\ (c >= d) => (x >= d) */
+ Node lt = NodeManager::currentNM()->mkNode(NOT, geq);
+ lt.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(lt);
+ }
+ }
+ }
+}
+
+void ArithUnatePropagator::enqueueUpperBoundImplications(TNode atom, TNode orig, std::vector<Node>& buffer){
+
+ Assert(atom.getKind() == LEQ || (orig.getKind() == NOT && atom.getKind() == GEQ));
+
+ TNode left = atom[0];
+ TNode right = atom[1];
+ const Rational& c = right.getConst<Rational>();
+
+ OrderedBoundsList* eqList = left.getAttribute(propagator::PropagatorEqList());
+ OrderedBoundsList* leqList = left.getAttribute(propagator::PropagatorLeqList());
+ OrderedBoundsList* geqList = left.getAttribute(propagator::PropagatorGeqList());
+
+
+ //For every node (x <= d), we will restrict ourselves to look at the cases when (d >= c)
+ for(OrderedBoundsList::iterator i = leqList->lower_bound(atom); i != leqList->end(); ++i){
+ TNode leq = *i;
+ Assert(leq.getKind() == LEQ);
+ if(!leq.getAttribute(propagator::PropagatorMarked())){
+ leq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = leq[1].getConst<Rational>();
+ Assert( c <= d );
+
+ leq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(leq); // (x<=c) /\ (c <= d) => (x <= d)
+ //Note that if c=d, that at the node is not marked this can only be reached when (x < c)
+ //So we do not have to worry about a circular dependency
+ }else if(leq != atom){
+ break; //No need to examine the rest, this atom implies the rest of the possible propagataions
+ }
+ }
+
+ for(OrderedBoundsList::iterator i = geqList->upper_bound(atom); i != geqList->end(); ++i){
+ TNode geq = *i;
+ Assert(geq.getKind() == GEQ);
+ if(!geq.getAttribute(propagator::PropagatorMarked())){
+ geq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = geq[1].getConst<Rational>();
+ Assert( c < d );
+
+ Node lt = NodeManager::currentNM()->mkNode(NOT, geq);
+ lt.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(lt); // x<=c /\ d > c => x < d
+ }else{
+ break; //No need to examine this atom implies the rest
+ }
+ }
+
+ for(OrderedBoundsList::iterator i = eqList->upper_bound(atom); i != eqList->end(); ++i){
+ TNode eq = *i;
+ Assert(eq.getKind() == EQUAL);
+ if(!eq.getAttribute(propagator::PropagatorMarked())){
+ eq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = eq[1].getConst<Rational>();
+ Assert( c < d );
+
+ Node neq = NodeManager::currentNM()->mkNode(NOT, eq);
+ neq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(neq); // x<=c /\ c < d => x != d
+ }
+ }
+}
+
+void ArithUnatePropagator::enqueueLowerBoundImplications(TNode atom, TNode orig, std::vector<Node>& buffer){
+
+ Assert(atom.getKind() == GEQ || (orig.getKind() == NOT && atom.getKind() == LEQ));
+
+ TNode left = atom[0];
+ TNode right = atom[1];
+ const Rational& c = right.getConst<Rational>();
+
+ OrderedBoundsList* eqList = left.getAttribute(propagator::PropagatorEqList());
+ OrderedBoundsList* leqList = left.getAttribute(propagator::PropagatorLeqList());
+ OrderedBoundsList* geqList = left.getAttribute(propagator::PropagatorGeqList());
+
+
+ for(OrderedBoundsList::reverse_iterator i = geqList->reverse_lower_bound(atom);
+ i != geqList->rend(); i++){
+ TNode geq = *i;
+ Assert(geq.getKind() == GEQ);
+ if(!geq.getAttribute(propagator::PropagatorMarked())){
+ geq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = geq[1].getConst<Rational>();
+ Assert( c >= d );
+
+ geq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(geq); // x>=c /\ c >= d => x >= d
+ }else if(geq != atom){
+ break; //No need to examine the rest, this atom implies the rest of the possible propagataions
+ }
+ }
+
+ for(OrderedBoundsList::reverse_iterator i = leqList->reverse_upper_bound(atom);
+ i != leqList->rend(); ++i){
+ TNode leq = *i;
+ Assert(leq.getKind() == LEQ);
+ if(!leq.getAttribute(propagator::PropagatorMarked())){
+ leq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = leq[1].getConst<Rational>();
+ Assert( c > d );
+
+ Node gt = NodeManager::currentNM()->mkNode(NOT, leq);
+ gt.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(gt); // x>=c /\ d < c => x > d
+ }else{
+ break; //No need to examine this atom implies the rest
+ }
+ }
+
+ for(OrderedBoundsList::reverse_iterator i = eqList->reverse_upper_bound(atom);
+ i != eqList->rend(); ++i){
+ TNode eq = *i;
+ Assert(eq.getKind() == EQUAL);
+ if(!eq.getAttribute(propagator::PropagatorMarked())){
+ eq.setAttribute(propagator::PropagatorMarked(), true);
+ const Rational& d = eq[1].getConst<Rational>();
+ Assert( c > d );
+
+ Node neq = NodeManager::currentNM()->mkNode(NOT, eq);
+ neq.setAttribute(propagator::PropagatorExplanation(), orig);
+ buffer.push_back(neq); // x>=c /\ c > d => x != d
+ }
+ }
+
+}
+
+Node ArithUnatePropagator::explain(TNode lit){
+ Assert(lit.hasAttribute(propagator::PropagatorExplanation()));
+ return lit.getAttribute(propagator::PropagatorExplanation());
+}
diff --git a/src/theory/arith/arith_propagator.h b/src/theory/arith/arith_propagator.h
new file mode 100644
index 000000000..a623517fb
--- /dev/null
+++ b/src/theory/arith/arith_propagator.h
@@ -0,0 +1,111 @@
+
+
+#include "cvc4_private.h"
+
+#ifndef __CVC4__THEORY__ARITH__ARITH_PROPAGATOR_H
+#define __CVC4__THEORY__ARITH__ARITH_PROPAGATOR_H
+
+#include "expr/node.h"
+#include "context/cdlist.h"
+#include "context/context.h"
+#include "context/cdo.h"
+#include "theory/arith/ordered_bounds_list.h"
+
+#include <algorithm>
+#include <vector>
+
+namespace CVC4 {
+namespace theory {
+namespace arith {
+
+class ArithUnatePropagator {
+private:
+ /** Index of assertions. */
+ context::CDList<Node> d_assertions;
+
+ /** Index of the last assertion in d_assertions to be asserted. */
+ context::CDO<unsigned int> d_pendingAssertions;
+
+public:
+ ArithUnatePropagator(context::Context* cxt);
+
+ /**
+ * Adds a new atom for the propagator to watch.
+ * Atom is assumed to have been rewritten by TheoryArith::rewrite().
+ */
+ void addAtom(TNode atom);
+
+ /**
+ * Informs the propagator that a literal has been asserted to the theory.
+ */
+ void assertLiteral(TNode lit);
+
+
+ /**
+ * returns a vector of literals that are
+ */
+ std::vector<Node> getImpliedLiterals();
+
+ /** Explains a literal that was asserted in the current context. */
+ Node explain(TNode lit);
+
+private:
+ /** returns true if the left hand side side left has been setup. */
+ bool leftIsSetup(TNode left);
+
+ /**
+ * Sets up a left hand side.
+ * This initializes the attributes PropagatorEqList, PropagatorGeqList, and PropagatorLeqList for left.
+ */
+ void setupLefthand(TNode left);
+
+ /**
+ * Given that the literal lit is now asserted,
+ * enqueue additional entailed assertions in buffer.
+ */
+ void enqueueImpliedLiterals(TNode lit, std::vector<Node>& buffer);
+
+ void enqueueEqualityImplications(TNode original, std::vector<Node>& buffer);
+ void enqueueLowerBoundImplications(TNode atom, TNode original, std::vector<Node>& buffer);
+ /**
+ * Given that the literal original is now asserted, which is either (<= x c) or (not (>= x c)),
+ * enqueue additional entailed assertions in buffer.
+ */
+ void enqueueUpperBoundImplications(TNode atom, TNode original, std::vector<Node>& buffer);
+};
+
+
+
+namespace propagator {
+
+/** Basic memory management wrapper for deleting PropagatorEqList, PropagatorGeqList, and PropagatorLeqList.*/
+struct ListCleanupStrategy{
+ static void cleanup(OrderedBoundsList* l){
+ Debug("arithgc") << "cleaning up " << l << "\n";
+ delete l;
+ }
+};
+
+
+struct PropagatorEqListID {};
+typedef expr::Attribute<PropagatorEqListID, OrderedBoundsList*, ListCleanupStrategy> PropagatorEqList;
+
+struct PropagatorGeqListID {};
+typedef expr::Attribute<PropagatorGeqListID, OrderedBoundsList*, ListCleanupStrategy> PropagatorGeqList;
+
+struct PropagatorLeqListID {};
+typedef expr::Attribute<PropagatorLeqListID, OrderedBoundsList*, ListCleanupStrategy> PropagatorLeqList;
+
+
+struct PropagatorMarkedID {};
+typedef expr::CDAttribute<PropagatorMarkedID, bool> PropagatorMarked;
+
+struct PropagatorExplanationID {};
+typedef expr::CDAttribute<PropagatorExplanationID, Node> PropagatorExplanation;
+}/* CVC4::theory::arith::propagator */
+
+}/* CVC4::theory::arith namespace */
+}/* CVC4::theory namespace */
+}/* CVC4 namespace */
+
+#endif /* __CVC4__THEORY__ARITH__THEORY_ARITH_H */
diff --git a/src/theory/arith/ordered_bounds_list.h b/src/theory/arith/ordered_bounds_list.h
new file mode 100644
index 000000000..d21283afa
--- /dev/null
+++ b/src/theory/arith/ordered_bounds_list.h
@@ -0,0 +1,212 @@
+
+
+#include "cvc4_private.h"
+
+
+#ifndef __CVC4__THEORY__ARITH__ORDERED_BOUNDS_LIST_H
+#define __CVC4__THEORY__ARITH__ORDERED_BOUNDS_LIST_H
+
+#include "expr/node.h"
+#include "util/rational.h"
+#include "expr/kind.h"
+
+#include <vector>
+#include <algorithm>
+
+namespace CVC4 {
+namespace theory {
+namespace arith {
+
+struct RightHandRationalLT
+{
+ bool operator()(TNode s1, TNode s2) const
+ {
+ Assert(s1.getNumChildren() >= 2);
+ Assert(s2.getNumChildren() >= 2);
+
+ Assert(s1[1].getKind() == kind::CONST_RATIONAL);
+ Assert(s2[1].getKind() == kind::CONST_RATIONAL);
+
+ TNode rh1 = s1[1];
+ TNode rh2 = s2[1];
+ const Rational& c1 = rh1.getConst<Rational>();
+ const Rational& c2 = rh2.getConst<Rational>();
+ return c1.cmp(c2) < 0;
+ }
+};
+
+struct RightHandRationalGT
+{
+ bool operator()(TNode s1, TNode s2) const
+ {
+ Assert(s1.getNumChildren() >= 2);
+ Assert(s2.getNumChildren() >= 2);
+
+ Assert(s1[1].getKind() == kind::CONST_RATIONAL);
+ Assert(s2[1].getKind() == kind::CONST_RATIONAL);
+
+ TNode rh1 = s1[1];
+ TNode rh2 = s2[1];
+ const Rational& c1 = rh1.getConst<Rational>();
+ const Rational& c2 = rh2.getConst<Rational>();
+ return c1.cmp(c2) > 0;
+ }
+};
+
+/**
+ * An OrderedBoundsList is a lazily sorted vector of Arithmetic constraints.
+ * The intended use is for a list of rewriting arithmetic atoms.
+ * An example of such a list would be [(<= x 5);(= y 78); (>= x 9)].
+ *
+ * Nodes are required to have a CONST_RATIONAL child as their second node.
+ * Nodes are sorted in increasing order according to RightHandRationalLT.
+ *
+ * The lists are lazily sorted in the sense that the list is not sorted until
+ * an operation to access the element is attempted.
+ *
+ * An append() may make the list no longer sorted.
+ * After an append() operation all iterators for the list become invalid.
+ */
+class OrderedBoundsList {
+private:
+ bool d_isSorted;
+ std::vector<Node> d_list;
+
+public:
+ typedef std::vector<Node>::const_iterator iterator;
+ typedef std::vector<Node>::const_reverse_iterator reverse_iterator;
+
+ /**
+ * Constucts a new and empty OrderBoundsList.
+ * The empty list is initially sorted.
+ */
+ OrderedBoundsList() : d_isSorted(true){}
+
+ /**
+ * Appends a node onto the back of the list.
+ * The list may no longer be sorted.
+ */
+ void append(TNode n){
+ Assert(n.getNumChildren() >= 2);
+ Assert(n[1].getKind() == kind::CONST_RATIONAL);
+ d_isSorted = false;
+ d_list.push_back(n);
+ }
+
+ /** returns the size of the list */
+ unsigned int size(){
+ return d_list.size();
+ }
+
+ /** returns the i'th element in the sort list. This may sort the list.*/
+ TNode at(unsigned int idx){
+ sortIfNeeded();
+ return d_list.at(idx);
+ }
+
+ /** returns true if the list is known to be sorted. */
+ bool isSorted() const{
+ return d_isSorted;
+ }
+
+ /** sorts the list. */
+ void sort(){
+ d_isSorted = true;
+ std::sort(d_list.begin(), d_list.end(), RightHandRationalLT());
+ }
+
+ /**
+ * returns an iterator to the list that iterates in ascending order.
+ * This may sort the list.
+ */
+ iterator begin(){
+ sortIfNeeded();
+ return d_list.begin();
+ }
+ /**
+ * returns an iterator to the end of the list when interating in ascending order.
+ */
+ iterator end() const{
+ return d_list.end();
+ }
+
+ /**
+ * returns an iterator to the list that iterates in descending order.
+ * This may sort the list.
+ */
+ reverse_iterator rbegin(){
+ sortIfNeeded();
+ return d_list.rend();
+ }
+ /**
+ * returns an iterator to the end of the list when interating in descending order.
+ */
+ reverse_iterator rend() const{
+ return d_list.rend();
+ }
+
+ /**
+ * returns an iterator to the least strict upper bound of value.
+ * if the list is [(<= x 2);(>= x 80);(< y 70)]
+ * then *upper_bound((< z 70)) == (>= x 80)
+ *
+ * This may sort the list.
+ * see stl::upper_bound for more information.
+ */
+ iterator upper_bound(TNode value){
+ sortIfNeeded();
+ return std::upper_bound(begin(), end(), value, RightHandRationalLT());
+ }
+ /**
+ * returns an iterator to the greatest lower bound of value.
+ * This is bound is not strict.
+ * if the list is [(<= x 2);(>= x 80);(< y 70)]
+ * then *lower_bound((< z 70)) == (< y 70)
+ *
+ * This may sort the list.
+ * see stl::upper_bound for more information.
+ */
+ iterator lower_bound(TNode value){
+ sortIfNeeded();
+ return std::lower_bound(begin(), end(), value, RightHandRationalLT());
+ }
+ /**
+ * see OrderedBoundsList::upper_bound for more information.
+ * The difference is that the iterator goes in descending order.
+ */
+ reverse_iterator reverse_upper_bound(TNode value){
+ sortIfNeeded();
+ return std::upper_bound(rbegin(), rend(), value, RightHandRationalGT());
+ }
+ /**
+ * see OrderedBoundsList::lower_bound for more information.
+ * The difference is that the iterator goes in descending order.
+ */
+ reverse_iterator reverse_lower_bound(TNode value){
+ sortIfNeeded();
+ return std::lower_bound(rbegin(), rend(), value, RightHandRationalGT());
+ }
+
+ /**
+ * This is an O(n) method for searching the array to check if it contains n.
+ */
+ bool contains(TNode n) const {
+ for(std::vector<Node>::const_iterator i = d_list.begin(); i != d_list.end(); ++i){
+ if(*i == n) return true;
+ }
+ return false;
+ }
+private:
+ /** Sorts the list if it is not already sorted. */
+ void sortIfNeeded(){
+ if(!d_isSorted){
+ sort();
+ }
+ }
+};
+
+}/* CVC4::theory::arith namespace */
+}/* CVC4::theory namespace */
+}/* CVC4 namespace */
+
+#endif /* __CVC4__THEORY__ARITH__ORDERED_BOUNDS_LIST_H */
diff --git a/src/theory/arith/theory_arith.cpp b/src/theory/arith/theory_arith.cpp
index b3b7f58be..bd35e0797 100644
--- a/src/theory/arith/theory_arith.cpp
+++ b/src/theory/arith/theory_arith.cpp
@@ -34,6 +34,7 @@
#include "theory/arith/basic.h"
#include "theory/arith/arith_rewriter.h"
+#include "theory/arith/arith_propagator.h"
#include "theory/arith/theory_arith.h"
#include <map>
@@ -55,6 +56,7 @@ TheoryArith::TheoryArith(context::Context* c, OutputChannel& out) :
d_partialModel(c),
d_diseq(c),
d_rewriter(&d_constants),
+ d_propagator(c),
d_statistics()
{
uint64_t ass_id = partial_model::Assignment::getId();
@@ -81,6 +83,15 @@ TheoryArith::Statistics::Statistics():
StatisticsRegistry::registerStat(&d_statUpdateConflicts);
}
+TheoryArith::Statistics::~Statistics(){
+ StatisticsRegistry::unregisterStat(&d_statPivots);
+ StatisticsRegistry::unregisterStat(&d_statUpdates);
+ StatisticsRegistry::unregisterStat(&d_statAssertUpperConflicts);
+ StatisticsRegistry::unregisterStat(&d_statAssertLowerConflicts);
+ StatisticsRegistry::unregisterStat(&d_statUpdateConflicts);
+}
+
+
bool isBasicSum(TNode n){
if(n.getKind() != kind::PLUS) return false;
@@ -143,6 +154,8 @@ void TheoryArith::preRegisterTerm(TNode n) {
Assert(isNormalAtom(n));
+ d_propagator.addAtom(n);
+
TNode left = n[0];
TNode right = n[1];
if(left.getKind() == PLUS){
@@ -206,6 +219,10 @@ void TheoryArith::setupVariable(TNode x){
//lower bound. This is done to strongly enforce the notion that basic
//variables should not be changed without begin checked.
+ //Strictly speaking checking x is unnessecary as it cannot have an upper or
+ //lower bound. This is done to strongly enforce the notion that basic
+ //variables should not be changed without begin checked.
+
}
Debug("arithgc") << "setupVariable("<<x<<")"<<std::endl;
};
@@ -682,41 +699,69 @@ void TheoryArith::check(Effort level){
Debug("arith") << "TheoryArith::check begun" << std::endl;
while(!done()){
+
Node original = get();
Node assertion = simulatePreprocessing(original);
Debug("arith_assertions") << "arith assertion(" << original
<< " \\-> " << assertion << ")" << std::endl;
+ d_propagator.assertLiteral(original);
bool conflictDuringAnAssert = assertionCases(original, assertion);
+
if(conflictDuringAnAssert){
- if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
d_partialModel.revertAssignmentChanges();
- if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
-
return;
}
}
- if(fullEffort(level)){
- if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
+ //TODO This must be done everytime for the time being
+ if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
- Node possibleConflict = updateInconsistentVars();
- if(possibleConflict != Node::null()){
+ Node possibleConflict = updateInconsistentVars();
+ if(possibleConflict != Node::null()){
- d_partialModel.revertAssignmentChanges();
+ d_partialModel.revertAssignmentChanges();
- d_out->conflict(possibleConflict, true);
+ if(debugTagIsOn("arith::print-conflict"))
+ Debug("arith_conflict") << (possibleConflict) << std::endl;
- Debug("arith_conflict") <<"Found a conflict "<< possibleConflict << endl;
- }else{
- d_partialModel.commitAssignmentChanges();
- }
- if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
+ d_out->conflict(possibleConflict);
+
+ Debug("arith_conflict") <<"Found a conflict "<< possibleConflict << endl;
+ }else{
+ d_partialModel.commitAssignmentChanges();
}
+ if(debugTagIsOn("paranoid:check_tableau")){ checkTableau(); }
+
Debug("arith") << "TheoryArith::check end" << std::endl;
+ if(debugTagIsOn("arith::print_model")) {
+ Debug("arith::print_model") << "Model:" << endl;
+
+ for (unsigned i = 0; i < d_variables.size(); ++ i) {
+ Debug("arith::print_model") << d_variables[i] << " : " <<
+ d_partialModel.getAssignment(d_variables[i]);
+ if(isBasic(d_variables[i]))
+ Debug("arith::print_model") << " (basic)";
+ Debug("arith::print_model") << endl;
+ }
+ }
+ if(debugTagIsOn("arith::print_assertions")) {
+ Debug("arith::print_assertions") << "Assertions:" << endl;
+ for (unsigned i = 0; i < d_variables.size(); ++ i) {
+ Node x = d_variables[i];
+ if (x.hasAttribute(partial_model::LowerConstraint())) {
+ Node constr = d_partialModel.getLowerConstraint(x);
+ Debug("arith::print_assertions") << constr.toString() << endl;
+ }
+ if (x.hasAttribute(partial_model::UpperConstraint())) {
+ Node constr = d_partialModel.getUpperConstraint(x);
+ Debug("arith::print_assertions") << constr.toString() << endl;
+ }
+ }
+ }
}
/**
@@ -750,3 +795,23 @@ void TheoryArith::checkTableau(){
Assert(sum == shouldBe);
}
}
+
+
+void TheoryArith::explain(TNode n, Effort e) {
+ Node explanation = d_propagator.explain(n);
+ Debug("arith") << "arith::explain("<<explanation<<")->"
+ << explanation << endl;
+ d_out->explanation(explanation, true);
+}
+
+void TheoryArith::propagate(Effort e) {
+
+ if(quickCheckOrMore(e)){
+ std::vector<Node> implied = d_propagator.getImpliedLiterals();
+ for(std::vector<Node>::iterator i = implied.begin();
+ i != implied.end();
+ ++i){
+ d_out->propagate(*i);
+ }
+ }
+}
diff --git a/src/theory/arith/theory_arith.h b/src/theory/arith/theory_arith.h
index aff60f651..c76923bee 100644
--- a/src/theory/arith/theory_arith.h
+++ b/src/theory/arith/theory_arith.h
@@ -30,6 +30,7 @@
#include "theory/arith/tableau.h"
#include "theory/arith/arith_rewriter.h"
#include "theory/arith/partial_model.h"
+#include "theory/arith/arith_propagator.h"
#include "util/stats.h"
@@ -96,6 +97,7 @@ private:
*/
ArithRewriter d_rewriter;
+ ArithUnatePropagator d_propagator;
public:
TheoryArith(context::Context* c, OutputChannel& out);
@@ -115,8 +117,8 @@ public:
void registerTerm(TNode n);
void check(Effort e);
- void propagate(Effort e) { Unimplemented(); }
- void explain(TNode n, Effort e) { Unimplemented(); }
+ void propagate(Effort e);
+ void explain(TNode n, Effort e);
void shutdown(){ }
@@ -242,6 +244,7 @@ private:
IntStat d_statAssertLowerConflicts, d_statUpdateConflicts;
Statistics();
+ ~Statistics();
};
Statistics d_statistics;
diff --git a/src/theory/theory.cpp b/src/theory/theory.cpp
index e06c9594c..5e83d3728 100644
--- a/src/theory/theory.cpp
+++ b/src/theory/theory.cpp
@@ -103,5 +103,21 @@ Node Theory::get() {
return fact;
}
+std::ostream& operator<<(std::ostream& os, Theory::Effort level){
+ switch(level){
+ case Theory::MIN_EFFORT:
+ os << "MIN_EFFORT"; break;
+ case Theory::QUICK_CHECK:
+ os << "QUICK_CHECK:"; break;
+ case Theory::STANDARD:
+ os << "STANDARD"; break;
+ case Theory::FULL_EFFORT:
+ os << "FULL_EFFORT"; break;
+ default:
+ Unreachable();
+ }
+ return os;
+}
+
}/* CVC4::theory namespace */
}/* CVC4 namespace */
diff --git a/src/theory/theory.h b/src/theory/theory.h
index 1bf6f660c..6f4effe78 100644
--- a/src/theory/theory.h
+++ b/src/theory/theory.h
@@ -331,6 +331,8 @@ protected:
};/* class Theory */
+std::ostream& operator<<(std::ostream& os, Theory::Effort level);
+
}/* CVC4::theory namespace */
}/* CVC4 namespace */
diff --git a/src/theory/theory_engine.h b/src/theory/theory_engine.h
index c2511f4e6..15b406cdd 100644
--- a/src/theory/theory_engine.h
+++ b/src/theory/theory_engine.h
@@ -64,13 +64,22 @@ class TheoryEngine {
TheoryEngine* d_engine;
context::Context* d_context;
context::CDO<Node> d_conflictNode;
+ context::CDO<Node> d_explanationNode;
+
+ /**
+ * Literals that are propagated by the theory. Note that these are TNodes.
+ * The theory can only propagate nodes that have an assigned literal in the
+ * sat solver and are hence referenced in the SAT solver.
+ */
+ std::vector<TNode> d_propagatedLiterals;
public:
EngineOutputChannel(TheoryEngine* engine, context::Context* context) :
d_engine(engine),
d_context(context),
- d_conflictNode(context) {
+ d_conflictNode(context),
+ d_explanationNode(context){
}
void conflict(TNode conflictNode, bool safe) throw(theory::Interrupted, AssertionException) {
@@ -82,7 +91,9 @@ class TheoryEngine {
}
}
- void propagate(TNode, bool) throw(theory::Interrupted, AssertionException) {
+ void propagate(TNode lit, bool) throw(theory::Interrupted, AssertionException) {
+ d_propagatedLiterals.push_back(lit);
+ ++(d_engine->d_statistics.d_statPropagate);
++(d_engine->d_statistics.d_statPropagate);
}
@@ -94,7 +105,9 @@ class TheoryEngine {
++(d_engine->d_statistics.d_statAugLemma);
d_engine->newAugmentingLemma(node);
}
- void explanation(TNode, bool) throw(theory::Interrupted, AssertionException) {
+ void explanation(TNode explanationNode, bool) throw(theory::Interrupted, AssertionException) {
+ d_explanationNode = explanationNode;
+ ++(d_engine->d_statistics.d_statExplanatation);
++(d_engine->d_statistics.d_statExplanatation);
}
};
@@ -302,6 +315,7 @@ public:
inline bool check(theory::Theory::Effort effort)
{
d_theoryOut.d_conflictNode = Node::null();
+ d_theoryOut.d_propagatedLiterals.clear();
// Do the checking
try {
//d_bool.check(effort);
@@ -316,13 +330,23 @@ public:
return d_theoryOut.d_conflictNode.get().isNull();
}
+ inline const std::vector<TNode>& getPropagatedLiterals() const {
+ return d_theoryOut.d_propagatedLiterals;
+ }
+
+ void clearPropagatedLiterals() {
+ d_theoryOut.d_propagatedLiterals.clear();
+ }
+
inline void newLemma(TNode node) {
d_propEngine->assertLemma(node);
}
+
inline void newAugmentingLemma(TNode node) {
Node preprocessed = preprocess(node);
d_propEngine->assertFormula(preprocessed);
}
+
/**
* Returns the last conflict (if any).
*/
@@ -330,6 +354,21 @@ public:
return d_theoryOut.d_conflictNode;
}
+ inline void propagate() {
+ d_theoryOut.d_propagatedLiterals.clear();
+ // Do the propagation
+ d_uf.propagate(theory::Theory::FULL_EFFORT);
+ d_arith.propagate(theory::Theory::FULL_EFFORT);
+ }
+
+ inline Node getExplanation(TNode node){
+ d_theoryOut.d_explanationNode = Node::null();
+ theory::Theory* theory =
+ node.getKind() == kind::NOT ? theoryOf(node[0]) : theoryOf(node);
+ theory->explain(node);
+ return d_theoryOut.d_explanationNode;
+ }
+
private:
class Statistics {
public:
@@ -350,6 +389,7 @@ private:
};
Statistics d_statistics;
+
};/* class TheoryEngine */
}/* CVC4 namespace */
diff --git a/src/theory/theory_test_utils.h b/src/theory/theory_test_utils.h
new file mode 100644
index 000000000..dc08788f3
--- /dev/null
+++ b/src/theory/theory_test_utils.h
@@ -0,0 +1,81 @@
+
+
+#include "cvc4_public.h"
+
+
+#ifndef __CVC4__THEORY__THEORY_TEST_UTILS_H
+#define __CVC4__THEORY__ITHEORY_TEST_UTILS_H
+
+#include "util/Assert.h"
+#include "expr/node.h"
+#include "theory/output_channel.h"
+#include "theory/interrupted.h"
+
+#include <vector>
+
+namespace CVC4{
+
+namespace theory {
+
+/**
+ * Very basic OutputChannel for testing simple Theory Behaviour.
+ * Stores a call sequence for the output channel
+ */
+enum OutputChannelCallType { CONFLICT, PROPOGATE, AUG_LEMMA, LEMMA, EXPLANATION };
+
+
+class TestOutputChannel : public theory::OutputChannel {
+public:
+ std::vector< pair<enum OutputChannelCallType, Node> > d_callHistory;
+
+ TestOutputChannel() {}
+
+ ~TestOutputChannel() {}
+
+ void safePoint() throw(Interrupted, AssertionException) {}
+
+ void conflict(TNode n, bool safe = false) throw(Interrupted, AssertionException) {
+ push(CONFLICT, n);
+ }
+
+ void propagate(TNode n, bool safe = false) throw(Interrupted, AssertionException) {
+ push(PROPOGATE, n);
+ }
+
+ void lemma(TNode n, bool safe = false) throw(Interrupted, AssertionException) {
+ push(LEMMA, n);
+ }
+ void augmentingLemma(TNode n, bool safe = false) throw(Interrupted, AssertionException){
+ push(AUG_LEMMA, n);
+ }
+ void explanation(TNode n, bool safe = false) throw(Interrupted, AssertionException) {
+ push(EXPLANATION, n);
+ }
+
+ void clear() {
+ d_callHistory.clear();
+ }
+
+ Node getIthNode(int i) {
+ Node tmp = (d_callHistory[i]).second;
+ return tmp;
+ }
+
+ OutputChannelCallType getIthCallType(int i) {
+ return (d_callHistory[i]).first;
+ }
+
+ unsigned getNumCalls() {
+ return d_callHistory.size();
+ }
+
+private:
+ void push(OutputChannelCallType call, TNode n) {
+ d_callHistory.push_back(make_pair(call,n));
+ }
+};/* class TestOutputChannel */
+
+}/* namespace theory */
+}/* namespace CVC4 */
+
+#endif /* __CVC4__THEORY__THEORY_TEST_UTILS_H */
diff --git a/src/theory/uf/theory_uf.cpp b/src/theory/uf/theory_uf.cpp
index d13baf6a9..f440c3d0f 100644
--- a/src/theory/uf/theory_uf.cpp
+++ b/src/theory/uf/theory_uf.cpp
@@ -307,7 +307,7 @@ void TheoryUF::check(Effort level) {
merge();
}
- if(fullEffort(level)) {
+ if(standardEffortOrMore(level)) {
for(CDList<Node>::const_iterator diseqIter = d_disequality.begin();
diseqIter != d_disequality.end();
++diseqIter) {
generated by cgit on debian on lair
contact matthew@masot.net with questions or feedback